![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Amaki Public Profile..> | 15-Aug-2007 19:35 | 8.6K | |
| Amaki ref sheet.jpg | 04-Jun-2008 19:18 | 681K | |
| Anarak Amaki sm.jpg | 04-Jun-2008 19:19 | 122K | |
| Anya ethan.jpg | 20-Oct-2006 03:14 | 116K | |
| Anya ethan smaller.jpg | 20-Oct-2006 03:18 | 86K | |
| Arezou - The Dream W..> | 31-Oct-2007 13:38 | 51K | |
| Arezou - The Dream W..> | 31-Oct-2007 13:38 | 105K | |
| Bing Lin Amaki sm.jpg | 04-Jun-2008 19:17 | 74K | |
| Bing Lin Ethan sm.jpg | 04-Jun-2008 19:19 | 86K | |
| Black Ravyn Ethan.jpg | 31-Jul-2008 15:58 | 352K | |
| Bonnie Tay Amaki and..> | 04-Jun-2008 19:18 | 95K | |
| Carly Bayee Amaki sm..> | 04-Jun-2008 19:18 | 110K | |
| CarlyNene EthanSM.jpg | 04-Jun-2008 19:18 | 94K | |
| Charlie FINISHED ETH..> | 30-Jun-2008 14:36 | 379K | |
| Charlie Finished Eth..> | 20-Jun-2008 01:07 | 379K | |
| ChiiTheArtist Ethan.jpg | 31-Dec-2007 16:19 | 310K | |
| ChristineEthansm.jpg | 04-Jun-2008 19:18 | 134K | |
| Cillian's Chainsaw E..> | 31-Dec-2007 16:18 | 52K | |
| Club Drug Ethan.JPG | 21-Sep-2007 18:49 | 59K | |
| Col Silver ethan.jpg | 31-Dec-2008 17:50 | 251K | |
| Commish___Ethan_for_..> | 30-Sep-2008 15:43 | 95K | |
| David Keju ethan.jpg | 31-Dec-2007 16:19 | 316K | |
| Dora Tang Ethan sm.jpg | 04-Jun-2008 19:18 | 104K | |
| Ethan Ref Sheet.jpg | 19-May-2008 19:02 | 564K | |
| Ethan_by_Inkmo.jpg | 04-Jun-2008 19:19 | 149K | |
| Ethan char sheet ske..> | 06-Aug-2006 09:57 | 18K | |
| Ethan demon on trunk..> | 31-Oct-2007 13:38 | 75K | |
| Examples/ | 30-Nov-2008 06:22 | - | |
| FLuentSarcastist Eth..> | 31-Dec-2007 16:19 | 335K | |
| Furesiya Ethan.jpg | 31-Oct-2007 13:39 | 282K | |
| Ghost Writing 101 Et..> | 31-Oct-2007 13:38 | 17K | |
| GlassShard ethan.jpg | 30-Sep-2008 15:43 | 339K | |
| GunnerRomantic Ethan..> | 31-Jan-2008 18:00 | 90K | |
| Heather Ethan.jpg | 08-Aug-2007 18:27 | 46K | |
| Ivan Flores Ethan At..> | 30-Apr-2008 17:06 | 139K | |
| Ivan Flores Ethan Fe..> | 31-Mar-2009 16:18 | 97K | |
| IvanFlores amaki.jpg | 24-Apr-2008 16:32 | 201K | |
| Kai-Shii Ethan.jpg | 31-Oct-2007 13:38 | 379K | |
| Kelly is-chimera Eth..> | 04-Jun-2008 19:18 | 102K | |
| Kiragojira ethan2.jpg | 31-Jan-2008 18:00 | 215K | |
| Lady Kassurin ethan2..> | 30-Jun-2008 14:36 | 246K | |
| London009 Ethan.png | 28-Feb-2008 17:22 | 568K | |
| MikeWulf Ethan.jpg | 08-Aug-2007 18:27 | 195K | |
| Neithan Ethan.jpg | 21-Sep-2007 18:49 | 260K | |
| Nightmare Jester Eth..> | 04-Jun-2008 19:18 | 122K | |
| Omi Ethan.jpg | 31-Oct-2007 13:39 | 76K | |
| Original___Amaki_and..> | 30-Nov-2008 06:21 | 565K | |
| Psycho_kyugurl Ethan..> | 31-Oct-2007 13:39 | 226K | |
| Puppenmacher Ethan.jpg | 21-Sep-2007 18:49 | 30K | |
| Raging Hormones Etha..> | 31-Dec-2007 16:19 | 227K | |
| Reiben Prince Ethan.jpg | 02-Feb-2007 07:17 | 171K | |
| Resources/ | 10-Aug-2006 07:07 | - | |
| Rin Tau Ethan.jpg | 31-Oct-2007 13:38 | 187K | |
| Sayael Ethan.jpg | 08-Aug-2007 18:28 | 168K | |
| Spatterdash Ethan.JPG | 21-Sep-2007 18:49 | 199K | |
| Tavis Harts demonfor..> | 31-Jul-2008 15:58 | 99K | |
| Teh Ripper Ethan.jpg | 31-Oct-2007 13:38 | 102K | |
| Tessa Stone Amaki sm..> | 04-Jun-2008 19:18 | 217K | |
| Tessa Stone Ethansm.jpg | 04-Jun-2008 19:18 | 144K | |
| Thumbnails/ | 31-Mar-2009 16:18 | - | |
| Unibasu Ethan.jpg | 31-Dec-2007 16:19 | 76K | |
| Vince Price Amaki sm..> | 04-Jun-2008 19:18 | 102K | |
| Vince Price Ethan sm..> | 04-Jun-2008 19:18 | 110K | |
| Whizky ethan.jpg | 31-Dec-2007 16:19 | 130K | |
| WoefulInfinity Ethan..> | 21-Sep-2007 18:49 | 16K | |
| WoefulInfinity Ethan..> | 04-Jun-2008 19:18 | 91K | |
| alricsheet.jpg | 04-Jun-2008 19:19 | 253K | |
| bloodredcry26 Ethan.jpg | 31-Oct-2007 13:39 | 157K | |
| camy-chan Ethan smal..> | 28-Feb-2008 17:21 | 123K | |
| crossbon Ethan.jpg | 31-Jan-2008 18:00 | 107K | |
| dorian1.jpg | 15-Aug-2007 19:39 | 23K | |
| dorian2.jpg | 15-Aug-2007 19:39 | 30K | |
| dorianreference.jpg | 04-Jun-2008 19:19 | 240K | |
| earthkid Ethan.png | 31-Dec-2007 16:19 | 680K | |
| ethanart.htm | 31-Mar-2009 16:21 | 28K | |
| ethandemonformsm.jpg | 04-Jun-2008 19:19 | 90K | |
| ethanpromo.jpg | 05-Sep-2007 16:07 | 148K | |
| ethansoquili.png | 30-Apr-2008 17:06 | 442K | |
| ethanthumb.jpg | 02-Feb-2007 07:30 | 14K | |
| iced medication Etha..> | 31-Dec-2007 16:19 | 246K | |
| image001.jpg | 15-Aug-2007 19:29 | 27K | |
| image002.jpg | 15-Aug-2007 19:29 | 9.9K | |
| katsumiyo.jpg | 15-Aug-2007 19:33 | 39K | |
| newcampaignlog.htm | 08-Apr-2009 20:02 | 351K | |
| newcampaignlog_files/ | 09-Jan-2009 16:24 | - | |
| pach_work Ethan.jpg | 31-Dec-2007 16:19 | 304K | |
| phoxxhx Ethanedit.jpg | 31-Oct-2007 13:38 | 154K | |
| piratescampaignlog.htm | 25-Jun-2007 15:12 | 35K | |
| tolueno Ethan.jpg | 31-Oct-2007 13:38 | 63K | |
| y2jenn Ethan.jpg | 21-Sep-2007 18:49 | 43K | |
| yorugami ethan.png | 31-Oct-2007 13:39 | 537K | |
